On Target NA_INFB 0.36734694/CHEMBL4175983
For the given ligand ICV333, we have found in our database that, being scored 0.36734694, the most similar ligand is CHEMBL4175983. Check out the elaboration below.
| ICV333 (Given Ligand) | CHEMBL4175983 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cccc(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)c4 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N3CCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 100a4002 01800000 40100300 00110600 24000020 08002000 80000080 22001408 10a00880 001808d2 08382004 50039000 04028802 00300000 00000442 00000002 00044600 02000000 08000000 00000201 c0100100 18208600 2000e020 81500018 01040000 c0000001 00406000 d0000080 04408100 00060003 24040000 00812600 | 00074042 09007800 00100100 84010700 20180080 00002810 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00021448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |