On Target PLP_SARS 0.3030303/CHEMBL358279
For the given ligand ICV339, we have found in our database that, being scored 0.3030303, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| ICV339 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| C[C@H](C2C/C=C\c1ccccc12)N4CCC(C(=O)NCc3cccc(F)c3)CC4 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 000a0000 01800000 00100300 02110600 20000020 00002010 80000080 22001408 10200880 001828c2 08302000 50039000 04028802 00201000 00000422 00000002 00004600 02000000 00000000 00000201 80100100 18208600 0000c020 81500018 01000000 c0000001 00406000 d0000001 04400100 00068003 24040000 00812600 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |