On Target NS3_HCV1A 0.38650307/CHEMBL4115214
For the given ligand ICV801, we have found in our database that, being scored 0.38650307, the most similar ligand is CHEMBL4115214. Check out the elaboration below.
| ICV801 (Given Ligand) | CHEMBL4115214 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cc(F)cc(CNC(=O)C3CCN([C@H](C)c1cccc2ccccc12)CC3)c4 | CC[C@H](NC(=O)C[C@@H](N)C(C)C)c1ccc(Cl)c(C(=O)c2cccnc2)c1F |
|
|
|
|
|
|
| 10024002 01800000 40100100 02010600 04000100 08000010 00000000 22001000 04a00000 000868d0 08280004 70039000 04018802 00101000 00000460 00000000 00040000 02000000 08000000 00000201 c0100000 18008608 20002000 00500018 00040000 c0000001 00000000 90000081 00408100 00068003 20040000 00800600 | 080180c2 01805c00 00104100 02010610 00041201 00000010 30002000 23001000 00400800 00080fc0 08300004 40019a00 0e008866 00001004 00000400 080c000c 03010200 03000004 00200400 00000201 c0000500 18068700 21800000 3050001c 00042000 e0000200 08040000 d0800181 00400180 01068013 a4040000 00022600 |