On Target PA_INFA 0.36567163/CHEMBL463590
For the given ligand ICV801, we have found in our database that, being scored 0.36567163, the most similar ligand is CHEMBL463590. Check out the elaboration below.
| ICV801 (Given Ligand) | CHEMBL463590 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cc(F)cc(CNC(=O)C3CCN([C@H](C)c1cccc2ccccc12)CC3)c4 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 10024002 01800000 40100100 02010600 04000100 08000010 00000000 22001000 04a00000 000868d0 08280004 70039000 04018802 00101000 00000460 00000000 00040000 02000000 08000000 00000201 c0100000 18008608 20002000 00500018 00040000 c0000001 00000000 90000081 00408100 00068003 20040000 00800600 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 2a001400 01100800 001808c0 08300000 5001d800 86028826 00200000 00000400 00080008 00000000 02000000 00250018 00000201 00000100 18008b80 04008000 00500010 00003800 c0002400 00444000 90000000 00004100 00060002 24040000 00820600 |