On Target NSP15_SARS 0.29746836/CHEMBL2441741
For the given ligand ICV801, we have found in our database that, being scored 0.29746836, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| ICV801 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cc(F)cc(CNC(=O)C3CCN([C@H](C)c1cccc2ccccc12)CC3)c4 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 10024002 01800000 40100100 02010600 04000100 08000010 00000000 22001000 04a00000 000868d0 08280004 70039000 04018802 00101000 00000460 00000000 00040000 02000000 08000000 00000201 c0100000 18008608 20002000 00500018 00040000 c0000001 00000000 90000081 00408100 00068003 20040000 00800600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |