On Target NP_HCoV-OC43 0.31092438/CHEMBL3233481
For the given ligand ICV801, we have found in our database that, being scored 0.31092438, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV801 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cc(F)cc(CNC(=O)C3CCN([C@H](C)c1cccc2ccccc12)CC3)c4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 10024002 01800000 40100100 02010600 04000100 08000010 00000000 22001000 04a00000 000868d0 08280004 70039000 04018802 00101000 00000460 00000000 00040000 02000000 08000000 00000201 c0100000 18008608 20002000 00500018 00040000 c0000001 00000000 90000081 00408100 00068003 20040000 00800600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |