On Target PLP_SARS 0.43571427/CHEMBL358279
For the given ligand ICV801, we have found in our database that, being scored 0.43571427, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| ICV801 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cc(F)cc(CNC(=O)C3CCN([C@H](C)c1cccc2ccccc12)CC3)c4 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 10024002 01800000 40100100 02010600 04000100 08000010 00000000 22001000 04a00000 000868d0 08280004 70039000 04018802 00101000 00000460 00000000 00040000 02000000 08000000 00000201 c0100000 18008608 20002000 00500018 00040000 c0000001 00000000 90000081 00408100 00068003 20040000 00800600 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |