On Target NS5B_HCV1A 0.29565218/CHEMBL3644879
For the given ligand ICV346, we have found in our database that, being scored 0.29565218, the most similar ligand is CHEMBL3644879. Check out the elaboration below.
| ICV346 (Given Ligand) | CHEMBL3644879 (Similar Ligand) |
|---|---|
| CO/C\4=C/C(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)C/C=N4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(CCc2ccccc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 004a2000 29001000 00104300 00110e00 22041020 04302002 90080080 2000440a 10200880 001808cb 08312000 50039000 8402a002 08200000 02000c02 0010040a 20004e00 02000200 40000000 00000209 00100101 18240680 0000c020 81500818 01020000 80000003 41406040 d0040100 04404200 00060003 0c000000 40812600 | 00010080 0d403400 00100100 05310f00 00080000 00018000 000a0004 a0003408 10800280 005a89e8 08202400 4001b000 0e00f002 01042101 80400400 001a8008 02824018 02082000 40610850 00004201 00000100 bc250e10 01000003 b3440038 02013000 80001002 00000000 9020002c 0c000200 81060093 a4184000 01012670 |