On Target PLP_SARS 0.297561/CHEMBL213543
For the given ligand ICV346, we have found in our database that, being scored 0.297561, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| ICV346 (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| CO/C\4=C/C(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)C/C=N4 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 004a2000 29001000 00104300 00110e00 22041020 04302002 90080080 2000440a 10200880 001808cb 08312000 50039000 8402a002 08200000 02000c02 0010040a 20004e00 02000200 40000000 00000209 00100101 18240680 0000c020 81500818 01020000 80000003 41406040 d0040100 04404200 00060003 0c000000 40812600 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |