On Target PR_SARS 0.30337077/CHEMBL2441741
For the given ligand ICV333, we have found in our database that, being scored 0.30337077, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| ICV333 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CC(=O)Nc4cccc(CNC(=O)C3CCN([C@H](C)C2C/C=C\c1ccccc12)CC3)c4 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 100a4002 01800000 40100300 00110600 24000020 08002000 80000080 22001408 10a00880 001808d2 08382004 50039000 04028802 00300000 00000442 00000002 00044600 02000000 08000000 00000201 c0100100 18208600 2000e020 81500018 01040000 c0000001 00406000 d0000080 04408100 00060003 24040000 00812600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |