On Target RT_HIV1 0.48550725/CHEMBL3828596
For the given ligand ICV339, we have found in our database that, being scored 0.48550725, the most similar ligand is CHEMBL3828596. Check out the elaboration below.
| ICV339 (Given Ligand) | CHEMBL3828596 (Similar Ligand) |
|---|---|
| C[C@H](C2C/C=C\c1ccccc12)N4CCC(C(=O)NCc3cccc(F)c3)CC4 | C=C(C)[C@@H]1CC[C@]2(CNCCCN3CCCC3=O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 000a0000 01800000 00100300 02110600 20000020 00002010 80000080 22001408 10200880 001828c2 08302000 50039000 04028802 00201000 00000422 00000002 00004600 02000000 00000000 00000201 80100100 18208600 0000c020 81500018 01000000 c0000001 00406000 d0000001 04400100 00068003 24040000 00812600 | 00020000 01001c00 00100302 40050600 00000000 00004010 80000080 20000402 00000900 001809e0 08300000 40019800 04028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 180a0e30 00008020 0050001c 01200000 80000000 00406000 d0000000 00400002 01060013 e4020000 00802600 |