On Target NS5B_HCV1B 0.28691983/CHEMBL3645210
For the given ligand ICV339, we have found in our database that, being scored 0.28691983, the most similar ligand is CHEMBL3645210. Check out the elaboration below.
| ICV339 (Given Ligand) | CHEMBL3645210 (Similar Ligand) |
|---|---|
| C[C@H](C2C/C=C\c1ccccc12)N4CCC(C(=O)NCc3cccc(F)c3)CC4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)C3CCC3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 000a0000 01800000 00100300 02110600 20000020 00002010 80000080 22001408 10200880 001828c2 08302000 50039000 04028802 00201000 00000422 00000002 00004600 02000000 00000000 00000201 80100100 18208600 0000c020 81500018 01000000 c0000001 00406000 d0000001 04400100 00068003 24040000 00812600 | 00014006 0180de08 20180902 41310e00 210c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c33 01400211 808a0040 000e200e 04268000 02000004 08600008 00225203 e0100101 1c8b8e38 2080c800 9370001c 02104080 c0000048 00270080 9000108c 0c488104 0046005b c4048088 a81167e0 |