On Target NP_HCoV-OC43 0.16438356/CHEMBL3233481
For the given ligand ICV339, we have found in our database that, being scored 0.16438356, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| ICV339 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[C@H](C2C/C=C\c1ccccc12)N4CCC(C(=O)NCc3cccc(F)c3)CC4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 000a0000 01800000 00100300 02110600 20000020 00002010 80000080 22001408 10200880 001828c2 08302000 50039000 04028802 00201000 00000422 00000002 00004600 02000000 00000000 00000201 80100100 18208600 0000c020 81500018 01000000 c0000001 00406000 d0000001 04400100 00068003 24040000 00812600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |