On Target ACE2_HUMAN 0.23809524/CHEMBL253224
For the given ligand 2 Coumarinate, we have found in our database that, being scored 0.23809524, the most similar ligand is CHEMBL253224. Check out the elaboration below.
| 2 Coumarinate (Given Ligand) | CHEMBL253224 (Similar Ligand) |
|---|---|
| O=C(O)/C=C\c1ccccc1O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00200000 00000000 82000080 00000400 01800000 00000840 00000000 40008000 04008002 00000000 00000002 00082008 00000400 02000000 10018018 00020000 00000000 08000a00 00000000 00400000 00001000 80000000 00402000 40000000 00400000 00020000 04000000 00000002 | 00010000 01005008 20100100 00110600 00000080 00000000 82000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 80080000 00080008 10000000 02000000 00400008 00020201 00000100 18200e00 03000140 85500018 00000800 80000000 00120000 10000040 04000000 00060003 20004000 03012600 |