On Target ACE2_HUMAN 0.24675325/CHEMBL254900
For the given ligand 2, we have found in our database that, being scored 0.24675325, the most similar ligand is CHEMBL254900. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL254900 (Similar Ligand) |
|---|---|
| C=CCS(=O)CC([NH3+])C(=O)[O-] | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](C)C(=O)O |
|
|
|
|
|
|
| 00000000 44000000 20020020 00100400 01000000 00000000 00000000 00000400 00000000 00044000 00000000 40003000 00018000 00040000 80000000 00080008 04000000 00000000 00004000 00600000 40000000 00000a04 03000600 000c0010 00000200 00000000 00000000 00000010 00001000 00040120 04000000 03010020 | 00010000 01004000 00100000 00100400 00000080 00000000 80000000 20000000 00000000 02080080 00200000 40013000 06008002 00040000 80080000 00080008 10000000 00000000 00000000 00000201 00000000 10000e00 03000100 04100018 00000000 00000000 00000000 10000040 00000000 00040001 20004000 03010200 |