On Target GP_EBOV 0.109375/CHEMBL112570
For the given ligand 3, we have found in our database that, being scored 0.109375, the most similar ligand is CHEMBL112570. Check out the elaboration below.
| 3 (Given Ligand) | CHEMBL112570 (Similar Ligand) |
|---|---|
| C=CC1C/C=C\SS1 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00000000 40000010 60000000 40100000 00000000 80200900 00000000 00000400 00080008 00100000 40000000 40400000 10000000 00040000 00000000 00010000 00000000 00040000 00000400 00140001 00000040 00000000 00200000 00000010 00000000 00000100 00000001 80104010 00020000 00002000 04001000 01010000 | 00000000 01000000 00000800 00000000 00080000 00000000 00000000 00000402 00000000 00100008 00000200 40000000 00020000 00800000 00000404 00080008 00000000 00000020 02402000 00000001 00000000 00000000 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 |