On Target NA_INFB 0.06666667/CHEMBL309419
For the given ligand 3, we have found in our database that, being scored 0.06666667, the most similar ligand is CHEMBL309419. Check out the elaboration below.
| 3 (Given Ligand) | CHEMBL309419 (Similar Ligand) |
|---|---|
| C=CC1C/C=C\SS1 | CCO[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000000 40000010 60000000 40100000 00000000 80200900 00000000 00000400 00080008 00100000 40000000 40400000 10000000 00040000 00000000 00010000 00000000 00040000 00000400 00140001 00000040 00000000 00200000 00000010 00000000 00000100 00000001 80104010 00020000 00002000 04001000 01010000 | 00030000 09007000 00100000 80010500 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a04000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 00001400 00001400 00c04000 90000001 0c000200 00040401 04020000 00000210 |