On Target NA_INFB 0.14545454/CHEMBL370047
For the given ligand 2, we have found in our database that, being scored 0.14545454, the most similar ligand is CHEMBL370047. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL370047 (Similar Ligand) |
|---|---|
| C=CCS(=O)CC([NH3+])C(=O)[O-] | C/C=C\[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00000000 44000000 20020020 00100400 01000000 00000000 00000000 00000400 00000000 00044000 00000000 40003000 00018000 00040000 80000000 00080008 04000000 00000000 00004000 00600000 40000000 00000a04 03000600 000c0010 00000200 00000000 00000000 00000010 00001000 00040120 04000000 03010020 | 00010000 09003000 00100000 04000400 00080080 00000010 00080000 20000408 10000000 00108088 00200000 40013000 0602801a 01802001 80180400 00080008 10004000 00000040 00402000 00000201 00000000 30040e30 03008001 02100018 00000000 00000000 00404000 90000000 0c000000 00040401 24024000 00002200 |