On Target RDRP_SARS2 0.089605734/CHEMBL4065616
For the given ligand 2, we have found in our database that, being scored 0.089605734, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| C=CCS(=O)CC([NH3+])C(=O)[O-] | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00000000 44000000 20020020 00100400 01000000 00000000 00000000 00000400 00000000 00044000 00000000 40003000 00018000 00040000 80000000 00080008 04000000 00000000 00004000 00600000 40000000 00000a04 03000600 000c0010 00000200 00000000 00000000 00000010 00001000 00040120 04000000 03010020 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |