On Target PR_SARS 0.086021505/CHEMBL1092796
For the given ligand 3, we have found in our database that, being scored 0.086021505, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| 3 (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| C=CC1C/C=C\SS1 | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00000000 40000010 60000000 40100000 00000000 80200900 00000000 00000400 00080008 00100000 40000000 40400000 10000000 00040000 00000000 00010000 00000000 00040000 00000400 00140001 00000040 00000000 00200000 00000010 00000000 00000100 00000001 80104010 00020000 00002000 04001000 01010000 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |