On Target NSP15_SARS 0.091836736/CHEMBL1092796
For the given ligand 2, we have found in our database that, being scored 0.091836736, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| C=CCS(=O)CC([NH3+])C(=O)[O-] | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00000000 44000000 20020020 00100400 01000000 00000000 00000000 00000400 00000000 00044000 00000000 40003000 00018000 00040000 80000000 00080008 04000000 00000000 00004000 00600000 40000000 00000a04 03000600 000c0010 00000200 00000000 00000000 00000010 00001000 00040120 04000000 03010020 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |