On Target NP_HCoV-OC43 0.009708738/CHEMBL3233481
For the given ligand 3, we have found in our database that, being scored 0.009708738, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| 3 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C=CC1C/C=C\SS1 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000000 40000010 60000000 40100000 00000000 80200900 00000000 00000400 00080008 00100000 40000000 40400000 10000000 00040000 00000000 00010000 00000000 00040000 00000400 00140001 00000040 00000000 00200000 00000010 00000000 00000100 00000001 80104010 00020000 00002000 04001000 01010000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |