On Target NS3_HCV1A 0.29677418/CHEMBL4115214
For the given ligand chloroquine, we have found in our database that, being scored 0.29677418, the most similar ligand is CHEMBL4115214. Check out the elaboration below.
| chloroquine (Given Ligand) | CHEMBL4115214 (Similar Ligand) |
|---|---|
| CCN(CC)CCC[C@@H](C)Nc1ccnc2cc(Cl)ccc12 | CC[C@H](NC(=O)C[C@@H](N)C(C)C)c1ccc(Cl)c(C(=O)c2cccnc2)c1F |
|
|
|
|
|
|
| 0001c002 01000000 00104000 00000600 200c0000 00002000 08008000 20000000 00200000 000008c0 00200004 40038800 02000806 00400000 00020040 00040004 00040000 00000000 08200000 00000201 40100000 18048108 20800000 80100010 00006000 00000000 00008000 10000080 00008000 00060000 00040000 00420240 | 080180c2 01805c00 00104100 02010610 00041201 00000010 30002000 23001000 00400800 00080fc0 08300004 40019a00 0e008866 00001004 00000400 080c000c 03010200 03000004 00200400 00000201 c0000500 18068700 21800000 3050001c 00042000 e0000200 08040000 d0800181 00400180 01068013 a4040000 00022600 |