On Target NP_HCoV-OC43 0.37894738/CHEMBL3233481
For the given ligand chloroquine, we have found in our database that, being scored 0.37894738, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| chloroquine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCN(CC)CCC[C@@H](C)Nc1ccnc2cc(Cl)ccc12 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0001c002 01000000 00104000 00000600 200c0000 00002000 08008000 20000000 00200000 000008c0 00200004 40038800 02000806 00400000 00020040 00040004 00040000 00000000 08200000 00000201 40100000 18048108 20800000 80100010 00006000 00000000 00008000 10000080 00008000 00060000 00040000 00420240 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |