On Target NS3_HCV1A 0.33105803/CHEMBL3892606
For the given ligand Seed1, we have found in our database that, being scored 0.33105803, the most similar ligand is CHEMBL3892606. Check out the elaboration below.
| Seed1 (Given Ligand) | CHEMBL3892606 (Similar Ligand) |
|---|---|
| C[C@@H]4CCCN(Cc2cc(=O)n1[nH]c(=N)[nH]c1n2)c3ccccc34 | CC(C)c1ccc2c(Nc3cc(C(=O)Nc4ccc(-c5c[nH]c([C@@H]6CCCN6C(=O)Cc6ccccc6)n5)cc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 00004002 0120080a 60100193 08050f00 20820004 00106044 01800000 28203c01 07100b00 080c08e0 08314004 4001c800 04008006 00700000 00020460 080c000e 00848808 03808002 88400008 00220201 c0100100 1c018050 20810842 40540114 20006c00 c0008601 60220020 90161880 0008c105 04460002 e0008080 200006a1 | 1000c00a 01803a00 001a4d00 18190e10 04040060 0810601a 01409010 22083841 10802180 000808d0 08399004 6081d800 07008882 08918000 40020040 9a0c0106 04069000 76006023 0c60000a 52200a01 c1300000 182f8660 21816040 8158001f 00144001 80080200 022082d8 908010c0 2441c30c 01e60803 c004a8a0 200126e0 |