On Target NS5B_HCV1A 0.30147058/CHEMBL353549
For the given ligand Seed1, we have found in our database that, being scored 0.30147058, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Seed1 (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| C[C@@H]4CCCN(Cc2cc(=O)n1[nH]c(=N)[nH]c1n2)c3ccccc34 | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 00004002 0120080a 60100193 08050f00 20820004 00106044 01800000 28203c01 07100b00 080c08e0 08314004 4001c800 04008006 00700000 00020460 080c000e 00848808 03808002 88400008 00220201 c0100100 1c018050 20810842 40540114 20006c00 c0008601 60220020 90161880 0008c105 04460002 e0008080 200006a1 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |