On Target NS5B_HCV1B 0.37037036/CHEMBL3645210
For the given ligand Seed1, we have found in our database that, being scored 0.37037036, the most similar ligand is CHEMBL3645210. Check out the elaboration below.
| Seed1 (Given Ligand) | CHEMBL3645210 (Similar Ligand) |
|---|---|
| C[C@@H]4CCCN(Cc2cc(=O)n1[nH]c(=N)[nH]c1n2)c3ccccc34 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)C3CCC3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00004002 0120080a 60100193 08050f00 20820004 00106044 01800000 28203c01 07100b00 080c08e0 08314004 4001c800 04008006 00700000 00020460 080c000e 00848808 03808002 88400008 00220201 c0100100 1c018050 20810842 40540114 20006c00 c0008601 60220020 90161880 0008c105 04460002 e0008080 200006a1 | 00014006 0180de08 20180902 41310e00 210c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c33 01400211 808a0040 000e200e 04268000 02000004 08600008 00225203 e0100101 1c8b8e38 2080c800 9370001c 02104080 c0000048 00270080 9000108c 0c488104 0046005b c4048088 a81167e0 |