On Target ACE2_HUMAN 0.12605043/CHEMBL257026
For the given ligand Agapanthagenin, we have found in our database that, being scored 0.12605043, the most similar ligand is CHEMBL257026. Check out the elaboration below.
| Agapanthagenin (Given Ligand) | CHEMBL257026 (Similar Ligand) |
|---|---|
| CC1CCC6(OC1)OC5CC4C3CCC2(O)CC(O)C(O)CC2(C)C3CCC4(C)C5C6C | O=C(O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)[C@@H](S)C1CCCCC1 |
|
|
|
|
|
|
| 00000040 01000000 00000000 00010100 80280000 00000000 00000800 08000000 00200000 00000020 00000000 40008000 00000000 02800000 00080000 00281008 00800000 00000000 1340a000 00000001 00000020 00000000 05000000 00000010 00000400 00000000 00000000 24000000 00000200 01000000 00220000 00000000 | 00012000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00200980 020a08c0 08300000 4003b800 0600800a 00040000 80080000 00080008 10020000 02000000 06402008 10000201 00000100 18200e10 13000140 85500018 00000800 80000000 00000000 10000040 04004000 00060003 20024000 03012600 |