On Target PR_HIV1 0.13714285/CHEMBL3645124
For the given ligand 2 Coumarinate, we have found in our database that, being scored 0.13714285, the most similar ligand is CHEMBL3645124. Check out the elaboration below.
| 2 Coumarinate (Given Ligand) | CHEMBL3645124 (Similar Ligand) |
|---|---|
| O=C(O)/C=C\c1ccccc1O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CC3OCO[C@@H]3C2)cc1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00200000 00000000 82000080 00000400 01800000 00000840 00000000 40008000 04008002 00000000 00000002 00082008 00000400 02000000 10018018 00020000 00000000 08000a00 00000000 00400000 00001000 80000000 00402000 40000000 00400000 00020000 04000000 00000002 | 00000010 01c05408 2110010a 01b10700 00281080 00028004 02000800 a8000004 00740a00 014809e0 08302000 60018000 00008002 02200101 81e80001 003a0008 10822000 02080000 11408800 01027603 80000100 18280c90 07100040 d9500058 02000000 8000100e 00800000 3420008c 04000600 2106001b 80a00000 00012670 |