On Target RT_HIV1 0.40983605/CHEMBL404519
For the given ligand Agapanthagenin, we have found in our database that, being scored 0.40983605, the most similar ligand is CHEMBL404519. Check out the elaboration below.
| Agapanthagenin (Given Ligand) | CHEMBL404519 (Similar Ligand) |
|---|---|
| CC1CCC6(OC1)OC5CC4C3CCC2(O)CC(O)C(O)CC2(C)C3CCC4(C)C5C6C | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(=O)CC(C)(C)C(=O)O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000040 01000000 00000000 00010100 80280000 00000000 00000800 08000000 00200000 00000020 00000000 40008000 00000000 02800000 00080000 00281008 00800000 00000000 1340a000 00000001 00000020 00000000 05000000 00000010 00000400 00000000 00000000 24000000 00000200 01000000 00220000 00000000 | 00050040 01000000 00000100 00010300 00280000 00000000 00000000 00000400 00000000 00108008 00000000 40009000 04008008 00800000 00000400 00081008 00820000 00000100 12402000 00000001 00000020 00000a00 01000000 00000010 00000400 00000000 00000000 80000000 00000202 01000002 24020000 00000000 |