On Target NS5B_HCV1B 0.14666666/CHEMBL3970609
For the given ligand Agapanthagenin, we have found in our database that, being scored 0.14666666, the most similar ligand is CHEMBL3970609. Check out the elaboration below.
| Agapanthagenin (Given Ligand) | CHEMBL3970609 (Similar Ligand) |
|---|---|
| CC1CCC6(OC1)OC5CC4C3CCC2(O)CC(O)C(O)CC2(C)C3CCC4(C)C5C6C | CO[C@]1(c2ccc3c(N)ncnn23)O[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@]1(C)C#N |
|
|
|
|
|
|
| 00000040 01000000 00000000 00010100 80280000 00000000 00000800 08000000 00200000 00000020 00000000 40008000 00000000 02800000 00080000 00281008 00800000 00000000 1340a000 00000001 00000020 00000000 05000000 00000010 00000400 00000000 00000000 24000000 00000200 01000000 00220000 00000000 | 0000080a 81004009 e2401512 19010f20 052c8074 0012c024 0381e800 00200a80 1060cb00 010c0060 08108004 4a839040 00000802 02b30020 000e0040 022cba0c 09cb8820 0680000e 1160a008 00665203 40100121 2c008860 a5801cc6 08600110 40000400 80002102 160880c0 a40508a0 0040020e 00c6cc16 41600280 6220ac82 |