On Target RDRP_SARS2 0.10218978/CHEMBL4065616
For the given ligand 2 Coumarinate, we have found in our database that, being scored 0.10218978, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| 2 Coumarinate (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| O=C(O)/C=C\c1ccccc1O | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00200000 00000000 82000080 00000400 01800000 00000840 00000000 40008000 04008002 00000000 00000002 00082008 00000400 02000000 10018018 00020000 00000000 08000a00 00000000 00400000 00001000 80000000 00402000 40000000 00400000 00020000 04000000 00000002 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |