On Target NP_HCoV-OC43 0.03/CHEMBL3233481
For the given ligand Agapanthagenin, we have found in our database that, being scored 0.03, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Agapanthagenin (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC1CCC6(OC1)OC5CC4C3CCC2(O)CC(O)C(O)CC2(C)C3CCC4(C)C5C6C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000040 01000000 00000000 00010100 80280000 00000000 00000800 08000000 00200000 00000020 00000000 40008000 00000000 02800000 00080000 00281008 00800000 00000000 1340a000 00000001 00000020 00000000 05000000 00000010 00000400 00000000 00000000 24000000 00000200 01000000 00220000 00000000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |