On Target NP_HCoV-OC43 0.15079366/CHEMBL3233481
For the given ligand Loperamide, we have found in our database that, being scored 0.15079366, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Loperamide (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CN(C)C(=O)C(CCN2CCC(O)(c1ccc(Cl)cc1)CC2)(c3ccccc3)c4ccccc4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00028000 01000200 00100100 00010600 00000000 00004000 00000000 21000000 00200900 000808c0 08300000 50039800 070080a6 00000000 40000000 000c0008 00000000 02000000 00800000 00000201 00000100 18200720 01000080 81500010 00002001 a0000000 00040000 50000000 04000080 0006000b 40002000 00822600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |