On Target RT_HIV1 0.41666666/CHEMBL4226544
For the given ligand Loperamide, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL4226544. Check out the elaboration below.
| Loperamide (Given Ligand) | CHEMBL4226544 (Similar Ligand) |
|---|---|
| CN(C)C(=O)C(CCN2CCC(O)(c1ccc(Cl)cc1)CC2)(c3ccccc3)c4ccccc4 | C=C(C)[C@@H]1CC[C@]2(CNCCCO)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00028000 01000200 00100100 00010600 00000000 00004000 00000000 21000000 00200900 000808c0 08300000 50039800 070080a6 00000000 40000000 000c0008 00000000 02000000 00800000 00000201 00000100 18200720 01000080 81500010 00002001 a0000000 00040000 50000000 04000080 0006000b 40002000 00822600 | 00000000 01000800 00100302 40050600 00000000 00004000 80000080 20000402 00000900 001808c0 08300000 40018800 00028002 00200000 00000402 00080008 00000400 02000020 02812000 00000201 01000100 18020a30 010080a0 00500014 01200001 80000000 00406000 d0000000 00400002 01060002 e4020000 00002600 |