On Target NS3_HCV1A 0.43065694/CHEMBL3981499
For the given ligand Loperamid, we have found in our database that, being scored 0.43065694, the most similar ligand is CHEMBL3981499. Check out the elaboration below.
| Loperamid (Given Ligand) | CHEMBL3981499 (Similar Ligand) |
|---|---|
| CN(C)C(=O)C(CCN2CCC(O)(c1ccc(Cl)cc1)CC2)(c3ccccc3)c4ccccc4 | C[C@@H](CC(N)=O)N[C@@H](c1ccc(Cl)c(C(=O)c2ccc(CO)cc2)c1F)C1CC1 |
|
|
|
|
|
|
| 00028000 01000200 00100100 00010600 00000000 00004000 00000000 21000000 00200900 000808c0 08300000 50039800 070080a6 00000000 40000000 000c0008 00000000 02000000 00800000 00000201 00000100 18200720 01000080 81500010 00002001 a0000000 00040000 50000000 04000080 0006000b 40002000 00822600 | 000080c0 01000c00 00100102 42050600 00000201 00004010 30000000 23001000 00000900 00080fc0 08300000 40009a00 0e008866 01201004 00000400 08080008 03000200 03000000 00000410 00000201 00000502 18028720 01000000 30400014 00003000 e0000200 08040000 d0800081 00000180 00068012 e4040000 00022600 |