On Target ACE2_HUMAN 0.45045045/CHEMBL400526
For the given ligand Loperamid, we have found in our database that, being scored 0.45045045, the most similar ligand is CHEMBL400526. Check out the elaboration below.
| Loperamid (Given Ligand) | CHEMBL400526 (Similar Ligand) |
|---|---|
| CN(C)C(=O)C(CCN2CCC(O)(c1ccc(Cl)cc1)CC2)(c3ccccc3)c4ccccc4 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00028000 01000200 00100100 00010600 00000000 00004000 00000000 21000000 00200900 000808c0 08300000 50039800 070080a6 00000000 40000000 000c0008 00000000 02000000 00800000 00000201 00000100 18200720 01000080 81500010 00002001 a0000000 00040000 50000000 04000080 0006000b 40002000 00822600 | 00010000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 80080000 00080008 10000000 02000000 00400008 00000201 00000100 18200e00 03000140 85500018 00000800 80000000 00000000 10000040 04000000 00060003 20004000 03012600 |