On Target PR_HIV1 0.25462964/CHEMBL3645128
For the given ligand Ribavirin, we have found in our database that, being scored 0.25462964, the most similar ligand is CHEMBL3645128. Check out the elaboration below.
| Ribavirin (Given Ligand) | CHEMBL3645128 (Similar Ligand) |
|---|---|
| NC(=O)c2ncn([C@@H]1O[C@H](CO)C(O)C1O)n2 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CC3OCCO[C@@H]3C2)cc1 |
|
|
|
|
|
|
| 00000004 01400008 c0100000 80010400 013800c0 00008004 00c00000 00000401 00000110 818000a0 08190028 44018810 00008000 03a00100 002a1080 001aa00c 00008000 00000002 19d00000 00201201 80180020 10000650 27014000 0e000410 10200410 40000402 00000800 31020060 01000305 00040001 80000080 00008108 | 00000010 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000044 00542a00 014809e0 08302000 60018000 00008002 02200101 81e80001 001a9008 10822000 02080000 11400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000100e 00800000 102200ac 04000600 2106001b 80000000 00012670 |