On Target NS3_HCV1A 0.32752612/CHEMBL3696817
For the given ligand LIGAND_65, we have found in our database that, being scored 0.32752612, the most similar ligand is CHEMBL3696817. Check out the elaboration below.
| LIGAND_65 (Given Ligand) | CHEMBL3696817 (Similar Ligand) |
|---|---|
| COC8OC7C(COC(=O)CCC(=O)NC4C(OCc1ccccc1)OC(COCc2ccccc2)C(OCc3ccccc3)C4OCc5ccccc5)OC(n6cnc(C(N)=O)n6)C7O8 | COc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(OC(C)C)O[C@H]2[C@@]1(C)N |
|
|
|
|
|
|
| 00060044 01405008 c0100508 80c10700 893800d0 0000c004 00c03800 28000441 00202110 818008e0 0c391028 44019810 04008002 03a90100 002a1088 023bb00c 10a28000 02000102 19d0a000 00201201 80180020 18140e70 37014080 0e500418 10200411 c0002402 00880a00 35020061 01000307 0006000b c0e00080 0280ab08 | 0000400a 01c01818 60080318 c1810f00 80180064 0008c004 1400ec41 80403808 00404100 818000f0 0c00900c 40059000 00001104 0b8a0120 01881884 101d8e0c 002e0020 00800008 39c00000 00247003 800a0020 3c000850 27800840 08400814 18000c40 40000202 0e060200 10010060 00000208 0046101c d1e84000 08298080 |