On Target ACE2_HUMAN 0.2780083/CHEMBL254493
For the given ligand LIGAND_65, we have found in our database that, being scored 0.2780083, the most similar ligand is CHEMBL254493. Check out the elaboration below.
| LIGAND_65 (Given Ligand) | CHEMBL254493 (Similar Ligand) |
|---|---|
| COC8OC7C(COC(=O)CCC(=O)NC4C(OCc1ccccc1)OC(COCc2ccccc2)C(OCc3ccccc3)C4OCc5ccccc5)OC(n6cnc(C(N)=O)n6)C7O8 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1OCc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00060044 01405008 c0100508 80c10700 893800d0 0000c004 00c03800 28000441 00202110 818008e0 0c391028 44019810 04008002 03a90100 002a1088 023bb00c 10a28000 02000102 19d0a000 00201201 80180020 18140e70 37014080 0e500418 10200411 c0002402 00880a00 35020061 01000307 0006000b c0e00080 0280ab08 | 04010000 01005008 20100108 00110600 00001080 80004000 86000000 20000204 00000980 020a08c0 08300000 4001b0c0 06808002 00050000 81080001 02082008 90000000 02008000 00400008 00020201 00000100 18200e20 03000140 85d01418 00004800 c0002000 00000000 10000040 04000300 00070003 60004000 03012600 |