On Target ACE2_HUMAN 0.21153846/CHEMBL411298
For the given ligand LIGAND 40, we have found in our database that, being scored 0.21153846, the most similar ligand is CHEMBL411298. Check out the elaboration below.
| LIGAND 40 (Given Ligand) | CHEMBL411298 (Similar Ligand) |
|---|---|
| C#CC4C16OPO/C=C1/OC5(n3cnc2c(=O)[nH]c(N)nc23)OC456 | CC(C)C[C@H](CP(=O)(O)[C@H]1CCCN1C(=O)OCc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 0080000a 81c41800 80081e00 81010f00 807829e4 0008c140 0082fc84 88083c00 16604100 81f000fa 8c00808c 4001d000 80009000 23c80100 02081484 113ed00c 01ab202c 00008000 39c1c010 0020d403 c0180128 1c000ed0 27800ac0 0c706814 10028405 c0200016 7e200202 b4050078 0003c218 00465020 d5e80800 8001c280 | 01010000 01403600 00100104 00090600 00090002 0000c010 00a00000 000a0000 00000780 000008c0 81200081 40109000 04008032 030b0001 0a100008 021a0008 00022029 02580400 0040c8a0 02008401 00000000 19341f70 01411801 81400018 00008000 94002016 00000002 10214200 00040200 a0060301 d0040000 0400c203 |