On Target PA_INFA 0.2266187/CHEMBL2040569
For the given ligand LIGAND_65, we have found in our database that, being scored 0.2266187, the most similar ligand is CHEMBL2040569. Check out the elaboration below.
| LIGAND_65 (Given Ligand) | CHEMBL2040569 (Similar Ligand) |
|---|---|
| COC8OC7C(COC(=O)CCC(=O)NC4C(OCc1ccccc1)OC(COCc2ccccc2)C(OCc3ccccc3)C4OCc5ccccc5)OC(n6cnc(C(N)=O)n6)C7O8 | O=C(NCC1CC1)c1nc(-c2cnccn2)[nH]c(=O)c1O |
|
|
|
|
|
|
| 00060044 01405008 c0100508 80c10700 893800d0 0000c004 00c03800 28000441 00202110 818008e0 0c391028 44019810 04008002 03a90100 002a1088 023bb00c 10a28000 02000102 19d0a000 00201201 80180020 18140e70 37014080 0e500418 10200411 c0002402 00880a00 35020061 01000307 0006000b c0e00080 0280ab08 | 00000202 00011808 40100100 10040e10 00000068 00124006 00c09800 28003405 16000100 401000a0 00290004 40040810 00008002 01708003 00820400 000c200c 08000068 1200b022 80c00000 10400201 00000000 50058600 21800040 4010011c 00044806 c0000680 28000030 90041004 0000410c 07660c01 e4008000 500002a0 |