On Target PR_HIV1 0.26948053/CHEMBL3645129
For the given ligand LIGAND 40, we have found in our database that, being scored 0.26948053, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| LIGAND 40 (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| C#CC4C16OPO/C=C1/OC5(n3cnc2c(=O)[nH]c(N)nc23)OC456 | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 0080000a 81c41800 80081e00 81010f00 807829e4 0008c140 0082fc84 88083c00 16604100 81f000fa 8c00808c 4001d000 80009000 23c80100 02081484 113ed00c 01ab202c 00008000 39c1c010 0020d403 c0180128 1c000ed0 27800ac0 0c706814 10028405 c0200016 7e200202 b4050078 0003c218 00465020 d5e80800 8001c280 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |