On Target RT_HIV1 0.3617021/CHEMBL3775172
For the given ligand LIGAND 70, we have found in our database that, being scored 0.3617021, the most similar ligand is CHEMBL3775172. Check out the elaboration below.
| LIGAND 70 (Given Ligand) | CHEMBL3775172 (Similar Ligand) |
|---|---|
| O=C(O)c6cc(C(c4cc(Cc3cc(C(c1ccc(O)c(C(=O)O)c1)c2ccc(O)c(C(=O)O)c2)cc(C(=O)O)c3O)cc(C(=O)O)c4O)=c5ccc(=O)c(C(=O)O)c5)ccc6O | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000002 80040808 20000100 00090280 40200001 00024001 82200280 03000e02 01000100 00180a40 28000000 40009200 14028002 20020000 00000002 0808600c 00000400 02000000 10490090 42022001 00002011 08020aa0 01408001 00400816 00201000 a0000400 00522008 c0800000 00404080 88220002 c6000000 01000400 | 00010000 01000800 00000302 40050200 00080000 00004000 80000080 00000402 00000900 00188848 08100000 40009800 04028008 00a00000 00000402 00080008 00000400 02000020 02402000 00000001 01000100 08020a20 01008020 00400014 01200000 80000000 00406000 c0000000 00400002 01020002 e4020000 00000400 |