On Target NS5B_HCV1A 0.28151262/CHEMBL348944
For the given ligand LIGAND_65, we have found in our database that, being scored 0.28151262, the most similar ligand is CHEMBL348944. Check out the elaboration below.
| LIGAND_65 (Given Ligand) | CHEMBL348944 (Similar Ligand) |
|---|---|
| COC8OC7C(COC(=O)CCC(=O)NC4C(OCc1ccccc1)OC(COCc2ccccc2)C(OCc3ccccc3)C4OCc5ccccc5)OC(n6cnc(C(N)=O)n6)C7O8 | CCC(C)[C@H](NC(=O)OCc1ccc(C(=O)O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00060044 01405008 c0100508 80c10700 893800d0 0000c004 00c03800 28000441 00202110 818008e0 0c391028 44019810 04008002 03a90100 002a1088 023bb00c 10a28000 02000102 19d0a000 00201201 80180020 18140e70 37014080 0e500418 10200411 c0002402 00880a00 35020061 01000307 0006000b c0e00080 0280ab08 | 01010000 01403800 00100100 44050600 00081000 0001c000 00000000 20000008 04800300 000008c0 00200000 4001f000 0e008002 00012001 80000000 021a0408 000a0000 02080401 00c00890 00000201 00000000 38160e70 01000083 0250001c 00001001 80002082 00000060 90200020 08000200 02060001 e0004000 00002200 |