On Target PLP_SARS 0.20496894/CHEMBL212080
For the given ligand LIGAND 40, we have found in our database that, being scored 0.20496894, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| LIGAND 40 (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| C#CC4C16OPO/C=C1/OC5(n3cnc2c(=O)[nH]c(N)nc23)OC456 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 0080000a 81c41800 80081e00 81010f00 807829e4 0008c140 0082fc84 88083c00 16604100 81f000fa 8c00808c 4001d000 80009000 23c80100 02081484 113ed00c 01ab202c 00008000 39c1c010 0020d403 c0180128 1c000ed0 27800ac0 0c706814 10028405 c0200016 7e200202 b4050078 0003c218 00465020 d5e80800 8001c280 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |