On Target NS3_HCV1A 0.024096385/CHEMBL3645672
For the given ligand test, we have found in our database that, being scored 0.024096385, the most similar ligand is CHEMBL3645672. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3645672 (Similar Ligand) |
|---|---|
| N.S.F | CC[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1CC)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00010200 | 000100a0 01003000 06100000 05200400 00000000 00000010 00020000 20001008 00000000 0000c180 00602000 40013000 0601801a 01002011 a0400000 00000000 04000000 00000000 06002000 00004201 00000000 30040630 00000003 32900038 00000000 00000000 00000000 10000010 08000000 40040001 60024004 00012260 |