On Target NS5B_HCV1A 0.013513514/CHEMBL435857
For the given ligand test, we have found in our database that, being scored 0.013513514, the most similar ligand is CHEMBL435857. Check out the elaboration below.
| test (Given Ligand) | CHEMBL435857 (Similar Ligand) |
|---|---|
| N.S.F | Cc1cc(Cl)ccc1S(=O)(=O)Nc1cc(-c2ccccc2)sc1C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00010200 | 00c1a052 04800a00 11000902 41b50a20 00000200 10034202 04040080 0c9200a8 00001100 00201841 04002200 60009a80 02148414 80020003 803a3000 00080008 01032080 02004818 04400000 10006010 80002000 48000b80 30140040 1840000c 02242200 84080000 10000200 8000024c 0000440a 20060000 c0000000 10c30260 |