On Target NA_INFB 0.016/CHEMBL373336
For the given ligand test, we have found in our database that, being scored 0.016, the most similar ligand is CHEMBL373336. Check out the elaboration below.
| test (Given Ligand) | CHEMBL373336 (Similar Ligand) |
|---|---|
| N.S.F | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1nccs1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00010200 | 0403000a 01003000 00100020 14080400 00080080 00000010 030000a0 20018008 00000000 00400280 00208a00 d0013000 0600a05a 01802001 831a2000 000c400c 10000000 0c000080 00406018 00000201 20100800 70040eb0 23000001 02110018 02003000 0e000004 00000000 10000384 08000004 00861001 18024000 20812a10 |