On Target PLP_SARS 0.01724138/CHEMBL212218
For the given ligand test, we have found in our database that, being scored 0.01724138, the most similar ligand is CHEMBL212218. Check out the elaboration below.
| test (Given Ligand) | CHEMBL212218 (Similar Ligand) |
|---|---|
| N.S.F | Cc1cc(S(=O)(=O)c2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])c(Cl)cc1Cl |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00010200 | 00008002 00c01210 00120100 00910200 00040100 08010020 00000400 10000000 14000000 00004870 04002004 60008804 02010005 01010400 a03001c0 00000010 04041100 02004000 00200000 00002140 c0022004 0c604100 20800820 08480c09 000c6000 c0080200 10244010 b0006020 00c00200 01060200 00120000 04030220 |